diammonium salt, 98%, ACROS Organics™
| CAS | 3012-65-5 |
|---|---|
| Molecular Formula | C6H14N2O7 |
| Molecular Weight (g/mol) | 226.185 |
| MDL Number | MFCD00013068 |
| InChI Key | YXVFQADLFFNVDS-UHFFFAOYSA-N |
| Synonym | Diammoniumcitrate |
| PubChem CID | 13710713 |
| ChEBI | CHEBI:63076 |
| Citric acid, diammonium salt | |
| Pure | |
| 98% | |
| MFCD00013068 | |
| Diammoniumcitrate | |
| YXVFQADLFFNVDS-UHFFFAOYSA-N | |
| azane;2-hydroxypropane-1,2,3-tricarboxylic acid | |
| 13710713 | |
| 226.19 | |
| Authentic | |
| 1.5 | |
| White |
| 3012-65-5 | |
| 98% | |
| C6H14N2O7 | |
| 15, 509 | |
| 1.5000g/mL | |
| C(C(=O)O)C(CC(=O)O)(C(=O)O)O.N.N | |
| 226.185 | |
| CHEBI:63076 | |
| Crystalline Powder | |
| Plastic bottle | |
| Solubility in water: soluble. | |
| 2.5kg |
NIST Standard Solution, ready to use, for volumetric analysis, Fisher Chemical
View Details
SLR, Extra Pure, Fisher Chemical
View DetailsNIST Standard Solution Ready To Use, for Volumetric Analysis, Fisher Chemical
View DetailsCertified AR for Analysis, Fisher Chemical
View Details
Reviews
There are no reviews yet.